Products 2940955-08-6

CAS 2940955-08-6 is the registry number for tert-butyl 2-(azetidin-3-yl)azetidine-1-carboxylate hemi(oxalic acid), 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 2-(azetidin-3-yl)azetidine-1-carboxylate);oxalic acid (CAS 2940955-08-6) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 2-(azetidin-3-yl)azetidine-1-carboxylate);oxalic acid. InChIKey: DDQKTKYWOFTTGT-UHFFFAOYSA-N.

Identity
Molecular formulaC24H42N4O8
Molecular weight514.6 g/mol
IUPAC namebis(tert-butyl 2-(azetidin-3-yl)azetidine-1-carboxylate);oxalic acid
InChIKeyDDQKTKYWOFTTGT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC1C2CNC2.CC(C)(C)OC(=O)N1CCC1C2CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)