Products 1629904-92-2

CAS 1629904-92-2 is the registry number for tert-Butyl 2,5-diazabicyclo(2.2.2)octane-2-carboxylate hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Bis(tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate);oxalic acid (CAS 1629904-92-2) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate);oxalic acid. InChIKey: YMUWTMSXSLCERU-UHFFFAOYSA-N.

Identity
Molecular formulaC24H42N4O8
Molecular weight514.6 g/mol
IUPAC namebis(tert-butyl 2,5-diazabicyclo[2.2.2]octane-2-carboxylate);oxalic acid
InChIKeyYMUWTMSXSLCERU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2CCC1CN2.CC(C)(C)OC(=O)N1CC2CCC1CN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)