CAS 1630906-60-3 appears in our catalog under these names: tert-Butyl 2,5-diazaspiro[3.4]octane-5-carboxylate hemioxalate, 95%, tert-Butyl 2,5-diazaspiro(3.4)octane-5-carboxylate hemioxalate, 97%, tert-Butyl 2,5-diazaspiro[3.4]octane-5-carboxylate hemioxalate, 97%, 97%, tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate hemioxalate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 100mg, 500mg, 5g.
Bis(tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate);oxalic acid (CAS 1630906-60-3) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate);oxalic acid. InChIKey: HAGQSTKTUAYTMX-UHFFFAOYSA-N.
| Molecular formula | C24H42N4O8 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | bis(tert-butyl 2,5-diazaspiro[3.4]octane-5-carboxylate);oxalic acid |
| InChIKey | HAGQSTKTUAYTMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CNC2.CC(C)(C)OC(=O)N1CCCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)