CAS 1788054-74-9 appears in our catalog under these names: tert-Butyl 1,6-diazaspiro[3.4]octane-1-carboxylate hemioxalate, 95%, tert-Butyl 1,6-diazaspiro[3.4]octane-1-carboxylate oxalate(2:1) 98%, tert-Butyl 1,6-diazaspiro[3.4]octane-1-carboxylate oxalate(2:1), 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
Bis(tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate);oxalic acid (CAS 1788054-74-9) is a chemical compound with the molecular formula C24H42N4O8 and a molecular weight of 514.6 g/mol. IUPAC name: bis(tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate);oxalic acid. InChIKey: DNHJCRBVFAVRNN-UHFFFAOYSA-N.
| Molecular formula | C24H42N4O8 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | bis(tert-butyl 1,7-diazaspiro[3.4]octane-1-carboxylate);oxalic acid |
| InChIKey | DNHJCRBVFAVRNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CCNC2.CC(C)(C)OC(=O)N1CCC12CCNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)