CAS 152786-27-1 appears in our catalog under these names: (S)-3-Amino-3-(4-hydroxy-phenyl)-propionic acid, 97%, (S)–3–Amino–3–(4–hydroxy–phenyl)–propionic acid, (S)-3-Amino-3-(4-hydroxyphenyl)propanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid (CAS 152786-27-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid. InChIKey: JYPHNHPXFNEZBR-QMMMGPOBSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JYPHNHPXFNEZBR-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)O |
Computed by PubChem (NCBI)