CAS 73025-69-1 appears in our catalog under these names: (R)-3-Amino-3-(4-hydroxyphenyl)propanoic acid hydrochloride 98%, (R)-3-Amino-3-(4-hydroxyphenyl)propanoic acid hydrochloride, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(R)-3-Amino-3-(4-hydroxy-phenyl)-propionic acid is an organonitrogen compound and an organooxygen compound. It is functionally related to a beta-amino acid.
Source: ChEBI
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JYPHNHPXFNEZBR-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)O |
Computed by PubChem (NCBI)