CAS 73025-68-0 appears in our catalog under these names: (R)-3-Amino-3-(4-hydroxy-phenyl)-propionic acid, 97%, (R)-3-Amino-3-(4-hydroxyphenyl)propanoic acid, 97%, (R)-3-Amino-3-(4-hydroxyphenyl)propanoic acid 97%, (R)-3-Amino-3-(4-hydroxy-phenyl)-propionic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(R)-3-Amino-3-(4-hydroxy-phenyl)-propionic acid is an organonitrogen compound and an organooxygen compound. It is functionally related to a beta-amino acid.
Source: ChEBI
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | JYPHNHPXFNEZBR-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)N)O |
Computed by PubChem (NCBI)