Products 152845-29-9
CAS 152845-29-9 is the registry number for 5-(2-Hydroxyethoxy)isophthalic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(2-hydroxyethoxy)benzene-1,3-dicarboxylic acid (CAS 152845-29-9) is a chemical compound with the molecular formula C10H10O6 and a molecular weight of 226.18 g/mol. IUPAC name: 5-(2-hydroxyethoxy)benzene-1,3-dicarboxylic acid. InChIKey: HWIOZYQYVYQVSP-UHFFFAOYSA-N.
| Molecular formula | C10H10O6 |
|---|---|
| Molecular weight | 226.18 g/mol |
| IUPAC name | 5-(2-hydroxyethoxy)benzene-1,3-dicarboxylic acid |
| InChIKey | HWIOZYQYVYQVSP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)OCCO)C(=O)O |
Computed by PubChem (NCBI)