Products 1528456-18-9
CAS 1528456-18-9 is the registry number for 6,8-Difluoro-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1528456-18-9) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: ARCSVLRWXYYGNH-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | ARCSVLRWXYYGNH-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2F)F)C(=O)O |
Computed by PubChem (NCBI)