Products 1535427-10-1
CAS 1535427-10-1 is the registry number for 1-(3-Methylisoxazol-5-yl)cyclobutanecarboxylic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg.
1-(3-methyl-1,2-oxazol-5-yl)cyclobutane-1-carboxylic acid (CAS 1535427-10-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-(3-methyl-1,2-oxazol-5-yl)cyclobutane-1-carboxylic acid. InChIKey: VOOSCOYWTATOLN-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-(3-methyl-1,2-oxazol-5-yl)cyclobutane-1-carboxylic acid |
| InChIKey | VOOSCOYWTATOLN-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2(CCC2)C(=O)O |
Computed by PubChem (NCBI)