CAS 1536187-15-1 appears in our catalog under these names: 2-Ethoxy-1,3-benzoxazol-5-amine, 95%, 2-Ethoxy-1,3-benzoxazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-ethoxy-1,3-benzoxazol-5-amine (CAS 1536187-15-1) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-ethoxy-1,3-benzoxazol-5-amine. InChIKey: NSHMFXCXSMBONG-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-ethoxy-1,3-benzoxazol-5-amine |
| InChIKey | NSHMFXCXSMBONG-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=C(O1)C=CC(=C2)N |
Computed by PubChem (NCBI)