CAS 15371-06-9 appears in our catalog under these names: Apremilast Impurity 27, Apremilast Impurity B, 3-Acetamidophthalic Acid, >95% (HPLC), 3–Acetamidophthalic acid, 3-acetamidophthalic acid, 98%, 98%. Offered by: Chemat Brand, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 25mg, 5mg, 500mg, 50mg, 250mg, 1g.
3-acetamidophthalic acid (CAS 15371-06-9) is a chemical compound with the molecular formula C10H9NO5 and a molecular weight of 223.18 g/mol. IUPAC name: 3-acetamidophthalic acid. InChIKey: ONSCGVISIRLDJQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO5 |
|---|---|
| Molecular weight | 223.18 g/mol |
| IUPAC name | 3-acetamidophthalic acid |
| InChIKey | ONSCGVISIRLDJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)