Products 1538575-22-2
CAS 1538575-22-2 is the registry number for Paecilomide. Offered by: MedChemExpress. Available pack sizes: Get quote.
Trans-(1S,2S)-2-(4-hydroxy-6-oxo-1H-pyridin-3-yl)cyclohexane-1-carboxylic acid (CAS 1538575-22-2) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: trans-(1S,2S)-2-(4-hydroxy-6-oxo-1H-pyridin-3-yl)cyclohexane-1-carboxylic acid. InChIKey: NIEWBDAIEROLFK-YUMQZZPRSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | trans-(1S,2S)-2-(4-hydroxy-6-oxo-1H-pyridin-3-yl)cyclohexane-1-carboxylic acid |
| InChIKey | NIEWBDAIEROLFK-YUMQZZPRSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C2=CNC(=O)C=C2O)C(=O)O |
Computed by PubChem (NCBI)