CAS 1544622-02-7 appears in our catalog under these names: 2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pent-4-ynoic acid, 95%, 2-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)pent-4-ynoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-(2,5-dioxopyrrol-1-yl)pent-4-ynoic acid (CAS 1544622-02-7) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(2,5-dioxopyrrol-1-yl)pent-4-ynoic acid. InChIKey: RINSUTUWISGBJY-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(2,5-dioxopyrrol-1-yl)pent-4-ynoic acid |
| InChIKey | RINSUTUWISGBJY-UHFFFAOYSA-N |
| SMILES | C#CCC(C(=O)O)N1C(=O)C=CC1=O |
Computed by PubChem (NCBI)