CAS 154660-48-7 is the registry number for 2-Phenylbenzhydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-phenylbenzohydrazide (CAS 154660-48-7) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 2-phenylbenzohydrazide. InChIKey: URSYVWKUCWNLMA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 2-phenylbenzohydrazide |
| InChIKey | URSYVWKUCWNLMA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(=O)NN |
Computed by PubChem (NCBI)