CAS 154669-16-6 is the registry number for Erlotinib Impurity 94. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-nitrophenyl)-3-oxopropanal (CAS 154669-16-6) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 3-(3-nitrophenyl)-3-oxopropanal. InChIKey: JPUIHUPNEJKLES-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-3-oxopropanal |
| InChIKey | JPUIHUPNEJKLES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)CC=O |
Computed by PubChem (NCBI)