Products 15497-40-2
CAS 15497-40-2 is the registry number for 2,3-Dihydro-1H-indene-5-carbonyl Chloride. Offered by: TRC. Available pack sizes: 1g.
2,3-dihydro-1H-indene-5-carbonyl chloride (CAS 15497-40-2) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 2,3-dihydro-1H-indene-5-carbonyl chloride. InChIKey: CCTGNCRJXVHMAW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-indene-5-carbonyl chloride |
| InChIKey | CCTGNCRJXVHMAW-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)