CAS 1550905-76-4 is the registry number for 6-Fluoro-2,3-dihydro-1-benzofuran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6-fluoro-2,3-dihydro-1-benzofuran-3-carboxylic acid (CAS 1550905-76-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 6-fluoro-2,3-dihydro-1-benzofuran-3-carboxylic acid. InChIKey: QHAPTLOMIVNTQI-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 6-fluoro-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| InChIKey | QHAPTLOMIVNTQI-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)