Products 155239-30-8
CAS 155239-30-8 is the registry number for 5-Hydroxy-1,7-diphenylhept-6-en-3-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-5-hydroxy-1,7-diphenylhept-6-en-3-one (CAS 155239-30-8) is a chemical compound with the molecular formula C19H20O2 and a molecular weight of 280.4 g/mol. IUPAC name: (E)-5-hydroxy-1,7-diphenylhept-6-en-3-one. InChIKey: NEQGOKAKPXXESR-ACCUITESSA-N.
| Molecular formula | C19H20O2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | (E)-5-hydroxy-1,7-diphenylhept-6-en-3-one |
| InChIKey | NEQGOKAKPXXESR-ACCUITESSA-N |
| SMILES | C1=CC=C(C=C1)CCC(=O)CC(/C=C/C2=CC=CC=C2)O |
Computed by PubChem (NCBI)