CAS 155344-90-4 appears in our catalog under these names: MDAI (hydrochloride), 5,6-Methylenedioxy-2-aminoindane. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
6,7-dihydro-5H-cyclopenta[f][1,3]benzodioxol-6-amine;hydrochloride (CAS 155344-90-4) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 6,7-dihydro-5H-cyclopenta[f][1,3]benzodioxol-6-amine;hydrochloride. InChIKey: DEZYWEZDXRXACY-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 6,7-dihydro-5H-cyclopenta[f][1,3]benzodioxol-6-amine;hydrochloride |
| InChIKey | DEZYWEZDXRXACY-UHFFFAOYSA-N |
| SMILES | C1C(CC2=CC3=C(C=C21)OCO3)N.Cl |
Computed by PubChem (NCBI)