Products 1553990-37-6
CAS 1553990-37-6 is the registry number for 3,5-Difluoro-1H-indole-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3,5-difluoro-1H-indole-2-carboxylic acid (CAS 1553990-37-6) is a chemical compound with the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. IUPAC name: 3,5-difluoro-1H-indole-2-carboxylic acid. InChIKey: FRVMBOIRZXTQIQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F2NO2 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 3,5-difluoro-1H-indole-2-carboxylic acid |
| InChIKey | FRVMBOIRZXTQIQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=C(N2)C(=O)O)F |
Computed by PubChem (NCBI)