Products 15540-82-6
CAS 15540-82-6 is the registry number for 2,3-Dibromo-1,4-dimethyl-5-nitrobenzene, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,3-dibromo-1,4-dimethyl-5-nitrobenzene (CAS 15540-82-6) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 2,3-dibromo-1,4-dimethyl-5-nitrobenzene. InChIKey: NUFRALZMBQQGAM-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 2,3-dibromo-1,4-dimethyl-5-nitrobenzene |
| InChIKey | NUFRALZMBQQGAM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1Br)Br)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)