Products 15580-32-2
CAS 15580-32-2 appears in our catalog under these names: Malonanilic Acid, 3-Oxo-3-(phenylamino)propanoic acid, 95%, 95%, 3-Oxo-3-(phenylamino)propanoic acid, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
3-anilino-3-oxopropanoic acid (CAS 15580-32-2) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3-anilino-3-oxopropanoic acid. InChIKey: NOJXRHBIVBIMQY-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3-anilino-3-oxopropanoic acid |
| InChIKey | NOJXRHBIVBIMQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(phenylcarbamoyl)acetic acid, 3-Oxo-3-(phenylamino)propanoic acid, 3-anilino-3-oxopropanoic acid, Malonanilic acid, Propanoic acid, 3-oxo-3-(phenylamino)-, N-phenyl-malonamic acid, Propanoic acid,3-oxo-3-(phenylamino)-, N-Phenylmalonamic acid, Bionet2_000070, Malonic acid monophenylamide