Products 155814-23-6
CAS 155814-23-6 appears in our catalog under these names: 3-Fluoro-2-methylcinnamic acid, 95%, 3-Fluoro-2-methylcinnamic acid 98% +(E), 3-Fluoro-2-methylcinnamic acid, 98% +(E), 98% +(E), 3-Fluoro-2-methylcinnamic acid, 98+%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(E)-3-(3-fluoro-2-methylphenyl)prop-2-enoic acid (CAS 155814-23-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: (E)-3-(3-fluoro-2-methylphenyl)prop-2-enoic acid. InChIKey: NZDLRLIWXWVPES-AATRIKPKSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | (E)-3-(3-fluoro-2-methylphenyl)prop-2-enoic acid |
| InChIKey | NZDLRLIWXWVPES-AATRIKPKSA-N |
| SMILES | CC1=C(C=CC=C1F)/C=C/C(=O)O |
Computed by PubChem (NCBI)