CAS 39801-62-2 appears in our catalog under these names: 2-Phenyl-2-(trifluoroacetamido)acetic acid, 2-Phenyl-2-(trifluoroacetamido)acetic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid (CAS 39801-62-2) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid. InChIKey: AFPBGEGBLXHXNY-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]acetic acid |
| InChIKey | AFPBGEGBLXHXNY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)