CAS 156033-07-7 appears in our catalog under these names: Milrinone Impurity I, Milrinone Impurity 15, Milrinone Impurity 9. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(1-hydroxy-4-pyridinylidene)-6-methyl-2-oxopyridine-3-carbonitrile (CAS 156033-07-7) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 5-(1-hydroxy-4-pyridinylidene)-6-methyl-2-oxopyridine-3-carbonitrile. InChIKey: HPLWNXFXCQIZLO-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 5-(1-hydroxy-4-pyridinylidene)-6-methyl-2-oxopyridine-3-carbonitrile |
| InChIKey | HPLWNXFXCQIZLO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=O)C(=CC1=C2C=CN(C=C2)O)C#N |
Computed by PubChem (NCBI)