Products 1564055-36-2
CAS 1564055-36-2 is the registry number for 3-(4-Bromo-3-chlorophenyl)-3-chloroprop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(Z)-3-(4-bromo-3-chlorophenyl)-3-chloroprop-2-enenitrile (CAS 1564055-36-2) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: (Z)-3-(4-bromo-3-chlorophenyl)-3-chloroprop-2-enenitrile. InChIKey: JSLWDBOZZLJZQW-BAQGIRSFSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | (Z)-3-(4-bromo-3-chlorophenyl)-3-chloroprop-2-enenitrile |
| InChIKey | JSLWDBOZZLJZQW-BAQGIRSFSA-N |
| SMILES | C1=CC(=C(C=C1/C(=C/C#N)/Cl)Cl)Br |
Computed by PubChem (NCBI)