Products 1566665-88-0

CAS 1566665-88-0 is the registry number for Methyl 3-bromo-5-sulfanylbenzoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-bromo-5-sulfanylbenzoate (CAS 1566665-88-0) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: methyl 3-bromo-5-sulfanylbenzoate. InChIKey: LSEXQXGYNHMJEG-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO2S
Molecular weight247.11 g/mol
IUPAC namemethyl 3-bromo-5-sulfanylbenzoate
InChIKeyLSEXQXGYNHMJEG-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=CC(=C1)Br)S

Computed by PubChem (NCBI)