CAS 1569103-64-5 appears in our catalog under these names: N–Fmoc–N,O–dimethyl–L–serine, N-Fmoc-N,O-Dimethyl-L-Serine, 98%, 98%, N-Fmoc-N,O-dimethyl-L-serine, 98.25%, N-Fmoc-N,O-dimethyl-L-serine, 96%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g, 5 g, 1 g, 100 mg.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxypropanoic acid (CAS 1569103-64-5) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxypropanoic acid. InChIKey: CTHCRMIWFPLNJK-SFHVURJKSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methoxypropanoic acid |
| InChIKey | CTHCRMIWFPLNJK-SFHVURJKSA-N |
| SMILES | CN([C@@H](COC)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)