CAS 157665-52-6 appears in our catalog under these names: tert-Butyl 3-fluoro-4-nitrobenzoate 95%, TERT-BUTYL 3-FLUORO-4-NITROBENZOATE, 95%, 95%, tert-Butyl 3-fluoro-4-nitrobenzoate, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 2.5g, 10g.
Tert-butyl 3-fluoro-4-nitrobenzoate (CAS 157665-52-6) is a chemical compound with the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. IUPAC name: tert-butyl 3-fluoro-4-nitrobenzoate. InChIKey: CXQXHHIIMBWMCH-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO4 |
|---|---|
| Molecular weight | 241.22 g/mol |
| IUPAC name | tert-butyl 3-fluoro-4-nitrobenzoate |
| InChIKey | CXQXHHIIMBWMCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)