CAS 157684-00-9 appears in our catalog under these names: (R)-4-Chloro-homophenylalanine, 95%, H-D-HoPhe(4-Cl)-OH 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-amino-4-(4-chlorophenyl)butanoic acid (CAS 157684-00-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2R)-2-amino-4-(4-chlorophenyl)butanoic acid. InChIKey: AQUBLNVPEAFNGD-SECBINFHSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2R)-2-amino-4-(4-chlorophenyl)butanoic acid |
| InChIKey | AQUBLNVPEAFNGD-SECBINFHSA-N |
| SMILES | C1=CC(=CC=C1CC[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)