CAS 157684-01-0 appears in our catalog under these names: (S)-4-Chloro-homophenylalanine, 95%, H-L-HoPhe(4-Cl)-OH 95%, (S)-4-Chloro-homophenylalanine, 95%, 95%, (S)-2-Amino-4-(4-chlorophenyl)butanoic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S)-2-amino-4-(4-chlorophenyl)butanoic acid (CAS 157684-01-0) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2S)-2-amino-4-(4-chlorophenyl)butanoic acid. InChIKey: AQUBLNVPEAFNGD-VIFPVBQESA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2S)-2-amino-4-(4-chlorophenyl)butanoic acid |
| InChIKey | AQUBLNVPEAFNGD-VIFPVBQESA-N |
| SMILES | C1=CC(=CC=C1CC[C@@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)