Products 1580501-97-8
CAS 1580501-97-8 appears in our catalog under these names: (E)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, (2E)-TCO-PNB ester 95% rel-(1R-2E-pS)-axial, (E)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, 95% rel-(1R-2E-pS)-axial, 95% rel-(1R-2E-pS)-axial, (2E)-TCO-PNB ester, 99.69%, (E)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, 98%. Offered by: Biosynth, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg, 1g, 10 mg, 25 mg.
[(2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate (CAS 1580501-97-8) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate. InChIKey: XNTGBHHUEQUWSQ-XQRVVYSFSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate |
| InChIKey | XNTGBHHUEQUWSQ-XQRVVYSFSA-N |
| SMILES | C1CC/C=C\C(CC1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
(E)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, [(2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate, (Z)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, (2E)-TCO-PNB ester, Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, 2-Cyclooctenyl (E)-(4-Nitrophenyl) Carbonate, [(2E)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate