Products 2645443-14-5
CAS 2645443-14-5 appears in our catalog under these names: rel-(1R-2E-pR)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate 96% + rel-(1R-2E-pR)-equatorial, rel-(1R-2E-pR)-Cyclooct-2-en-1-yl (4-nitrophenyl) carbonate, 96% + rel-(1R-2E-pR)-equatorial, 96% + rel-(1R-2E-pR)-equatorial. Offered by: Ambeed, Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
[(1R,2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate (CAS 2645443-14-5) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: [(1R,2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate. InChIKey: XNTGBHHUEQUWSQ-AGLBCWCQSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | [(1R,2Z)-cyclooct-2-en-1-yl] (4-nitrophenyl) carbonate |
| InChIKey | XNTGBHHUEQUWSQ-AGLBCWCQSA-N |
| SMILES | C1CC/C=C\[C@@H](CC1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)