Products 1589545-88-9
CAS 1589545-88-9 is the registry number for 8-Methyldisporopsin 4'-methyl ether. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R)-5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2,3-dihydrochromen-4-one (CAS 1589545-88-9) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: (3R)-5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2,3-dihydrochromen-4-one. InChIKey: KCVAAPTXUYXVGT-LLVKDONJSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | (3R)-5,7-dihydroxy-3-[(2-hydroxy-4-methoxyphenyl)methyl]-8-methyl-2,3-dihydrochromen-4-one |
| InChIKey | KCVAAPTXUYXVGT-LLVKDONJSA-N |
| SMILES | CC1=C2C(=C(C=C1O)O)C(=O)[C@@H](CO2)CC3=C(C=C(C=C3)OC)O |
Computed by PubChem (NCBI)