Products 1590-22-3
CAS 1590-22-3 appears in our catalog under these names: 4-(2-Naphthyl)-4-oxobutyric acid, 4-(Naphthalen-2-yl)-4-oxobutanoic acid, 95%, 4-(Naphthalen-2-yl)-4-oxobutanoic acid, 97%, 4-(2-Naphthyl)-4-oxobutyric acid, 95%. Offered by: Biosynth, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 250mg, 2,5g, 100mg, 1g.
4-naphthalen-2-yl-4-oxobutanoic acid (CAS 1590-22-3) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 4-naphthalen-2-yl-4-oxobutanoic acid. InChIKey: GZKLCZIMSAHQDR-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 4-naphthalen-2-yl-4-oxobutanoic acid |
| InChIKey | GZKLCZIMSAHQDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=O)CCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(naphthalen-2-yl)-4-oxobutanoic acid, 4-(2-Naphthyl)-4-oxobutanoic acid, 4-(2-Naphthyl)-4-oxobutyric acid, 4-naphthalen-2-yl-4-oxobutanoic acid, 4-(2-naphthyl)-4-oxo-butanoic acid, 2-Naphthalenebutanoic acid, gamma-oxo-, 2-Naphthalenebutanoic acid, |A-oxo-, Oprea1_349989, IFLab1_000804, 3-[2-Naphtholyl]propionic acid