Products 159096-55-6
CAS 159096-55-6 is the registry number for 3,5-Dibromo-2-isopropoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3,5-dibromo-2-propan-2-yloxybenzoic acid (CAS 159096-55-6) is a chemical compound with the molecular formula C10H10Br2O3 and a molecular weight of 337.99 g/mol. IUPAC name: 3,5-dibromo-2-propan-2-yloxybenzoic acid. InChIKey: SBGCVJLIJCMBAG-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O3 |
|---|---|
| Molecular weight | 337.99 g/mol |
| IUPAC name | 3,5-dibromo-2-propan-2-yloxybenzoic acid |
| InChIKey | SBGCVJLIJCMBAG-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1Br)Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dibromo-2-isopropoxybenzoic acid