Products 1595747-83-3
CAS 1595747-83-3 appears in our catalog under these names: 1-(5-Chloro-2-fluoro-4-methylphenyl)ethanone, ≥95%, ≥95%, 5'-CHLORO-2'-FLUORO-4'-METHYLACETOPHENONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
1-(5-chloro-2-fluoro-4-methylphenyl)ethanone (CAS 1595747-83-3) is a chemical compound with the molecular formula C9H8ClFO and a molecular weight of 186.61 g/mol. IUPAC name: 1-(5-chloro-2-fluoro-4-methylphenyl)ethanone. InChIKey: ICTGPQKQPNSQSI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO |
|---|---|
| Molecular weight | 186.61 g/mol |
| IUPAC name | 1-(5-chloro-2-fluoro-4-methylphenyl)ethanone |
| InChIKey | ICTGPQKQPNSQSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C(=O)C)F |
Computed by PubChem (NCBI)