Products 1596355-59-7
CAS 1596355-59-7 is the registry number for Majoranaquinone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(hydroxymethyl)-2-methylbenzo[f][1]benzofuran-4,9-dione (CAS 1596355-59-7) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 3-(hydroxymethyl)-2-methylbenzo[f][1]benzofuran-4,9-dione. InChIKey: BMFBGDWXUYHRPW-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-(hydroxymethyl)-2-methylbenzo[f][1]benzofuran-4,9-dione |
| InChIKey | BMFBGDWXUYHRPW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C(=O)C3=CC=CC=C3C2=O)CO |
Computed by PubChem (NCBI)
Synonyms:
Majoranaquinone, orb2277479