CAS 159847-80-0 appears in our catalog under these names: Methyl 4-amino-3-cyanobenzoate, Methyl 4-amino-3-cyanobenzoate, 97%, 97%, Methyl 4-amino-3-cyanobenzoate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g.
Methyl 4-amino-3-cyanobenzoate (CAS 159847-80-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 4-amino-3-cyanobenzoate. InChIKey: QSPXZVQTLYMWEU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 4-amino-3-cyanobenzoate |
| InChIKey | QSPXZVQTLYMWEU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N)C#N |
Computed by PubChem (NCBI)