CAS 159847-81-1 appears in our catalog under these names: 2–Amino–5–cyanobenzoic acid methyl ester, Methyl 2-amino-5-cyanobenzoate, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 5g, 10g, 25g.
Methyl 2-amino-5-cyanobenzoate (CAS 159847-81-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: methyl 2-amino-5-cyanobenzoate. InChIKey: XVICOGIQWUAIAV-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | methyl 2-amino-5-cyanobenzoate |
| InChIKey | XVICOGIQWUAIAV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C#N)N |
Computed by PubChem (NCBI)