CAS 1601233-83-3 appears in our catalog under these names: 7-Bromo-1,5-dichloroisoquinoline, 95%, 7-Bromo-1,5-dichloroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-bromo-1,5-dichloroisoquinoline (CAS 1601233-83-3) is a chemical compound with the molecular formula C9H4BrCl2N and a molecular weight of 276.94 g/mol. IUPAC name: 7-bromo-1,5-dichloroisoquinoline. InChIKey: DYSWQNJERZQBLQ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrCl2N |
|---|---|
| Molecular weight | 276.94 g/mol |
| IUPAC name | 7-bromo-1,5-dichloroisoquinoline |
| InChIKey | DYSWQNJERZQBLQ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=C1C(=CC(=C2)Br)Cl)Cl |
Computed by PubChem (NCBI)