Products 1601461-35-1
CAS 1601461-35-1 is the registry number for (3R)-1-benzyloxycarbonyl-3-fluoro-pyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(3R)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1601461-35-1) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (3R)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: ASWSLWVUHJVOIR-CYBMUJFWSA-N.
| Molecular formula | C13H14FNO4 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | (3R)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | ASWSLWVUHJVOIR-CYBMUJFWSA-N |
| SMILES | C1CN(C[C@]1(C(=O)O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)