Products 2007910-44-1

CAS 2007910-44-1 is the registry number for 1-(2-Carboxy-3-fluorophenyl)piperidine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2-carboxy-3-fluorophenyl)piperidine-4-carboxylic acid (CAS 2007910-44-1) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: 1-(2-carboxy-3-fluorophenyl)piperidine-4-carboxylic acid. InChIKey: BMADRPNVFZQSEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14FNO4
Molecular weight267.25 g/mol
IUPAC name1-(2-carboxy-3-fluorophenyl)piperidine-4-carboxylic acid
InChIKeyBMADRPNVFZQSEJ-UHFFFAOYSA-N
SMILESC1CN(CCC1C(=O)O)C2=C(C(=CC=C2)F)C(=O)O

Computed by PubChem (NCBI)