CAS 2454397-64-7 is the registry number for Rel-(3R,4S)-1-((benzyloxy)carbonyl)-4-fluoropyrrolidine-3-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
(3S,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 2454397-64-7) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (3S,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: JQGKTZMTJXSICS-MNOVXSKESA-N.
| Molecular formula | C13H14FNO4 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | (3S,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid |
| InChIKey | JQGKTZMTJXSICS-MNOVXSKESA-N |
| SMILES | C1[C@H]([C@H](CN1C(=O)OCC2=CC=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)