Products 1601461-47-5

CAS 1601461-47-5 is the registry number for (3S)-1-benzyloxycarbonyl-3-fluoro-pyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

(3S)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 1601461-47-5) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (3S)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: ASWSLWVUHJVOIR-ZDUSSCGKSA-N.

Identity
Molecular formulaC13H14FNO4
Molecular weight267.25 g/mol
IUPAC name(3S)-3-fluoro-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid
InChIKeyASWSLWVUHJVOIR-ZDUSSCGKSA-N
SMILESC1CN(C[C@@]1(C(=O)O)F)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)