Products 1932069-39-0
CAS 1932069-39-0 is the registry number for (2R,4S)-1-[(benzyloxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 500mg, 1g.
(2R,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 1932069-39-0) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (2R,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: CORSVESTDJTBDT-WDEREUQCSA-N.
| Molecular formula | C13H14FNO4 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | (2R,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | CORSVESTDJTBDT-WDEREUQCSA-N |
| SMILES | C1[C@@H](CN([C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)