CAS 2089246-03-5 appears in our catalog under these names: (2R,4R)-1-((Benzyloxy)carbonyl)-4-fluoropyrrolidine-2-carboxylic acid, 97%, (2R,4R)-1-[(benzyloxy)carbonyl]-4-fluoropyrrolidine-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
(2R,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 2089246-03-5) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (2R,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: CORSVESTDJTBDT-GHMZBOCLSA-N.
| Molecular formula | C13H14FNO4 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | (2R,4R)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | CORSVESTDJTBDT-GHMZBOCLSA-N |
| SMILES | C1[C@H](CN([C@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)