CAS 72204-21-8 appears in our catalog under these names: (2S,4S)-1-((Benzyloxy)carbonyl)-4-fluoropyrrolidine-2-carboxylic acid, 98%, 98%, (2S,4S)-1-((BENZYLOXY)CARBONYL)-4-FLUOROPYRROLIDINE-2-CARBOXYLICACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 72204-21-8) is a chemical compound with the molecular formula C13H14FNO4 and a molecular weight of 267.25 g/mol. IUPAC name: (2S,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: CORSVESTDJTBDT-QWRGUYRKSA-N.
| Molecular formula | C13H14FNO4 |
|---|---|
| Molecular weight | 267.25 g/mol |
| IUPAC name | (2S,4S)-4-fluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | CORSVESTDJTBDT-QWRGUYRKSA-N |
| SMILES | C1[C@@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)