CAS 16019-34-4 appears in our catalog under these names: 4-Chloro-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidine, 99%, 99%, 7-BENZYL-4-CHLORO-7H-PYRROLO[2,3-D] PYRIMIDINE, 95%, 9-Benzyl-6-chloro-7-deazapurine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
7-benzyl-4-chloropyrrolo[2,3-d]pyrimidine (CAS 16019-34-4) is a chemical compound with the molecular formula C13H10ClN3 and a molecular weight of 243.69 g/mol. IUPAC name: 7-benzyl-4-chloropyrrolo[2,3-d]pyrimidine. InChIKey: KMWWCJXJJNHTQL-UHFFFAOYSA-N.
| Molecular formula | C13H10ClN3 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 7-benzyl-4-chloropyrrolo[2,3-d]pyrimidine |
| InChIKey | KMWWCJXJJNHTQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC3=C2N=CN=C3Cl |
Computed by PubChem (NCBI)